C25H27NO3 — CID 73441726
N,N-dibenzyl-3,4-diethoxybenzamide (PubChem CID 73441726) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is N,N-dibenzyl-3,4-diethoxybenzamide.
| Compound Name | N,N-dibenzyl-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 73441726 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | N,N-dibenzyl-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N(Cc2ccccc2)Cc2ccccc2)cc1OCC |
| InChI | InChI=1S/C25H27NO3/c1-3-28-23-16-15-22(17-24(23)29-4-2)25(27)26(18-20-11-7-5-8-12-20)19-21-13-9-6-10-14-21/h5-17H,3-4,18-19H2,1-2H3 |
| InChIKey | ZCGPBFPOSPNFIB-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |