C19H19BrN2O2 — CID 43911773
N-benzyl-3-bromo-N-(2-cyanoethyl)-4-ethoxybenzamide (PubChem CID 43911773) has the molecular formula C19H19BrN2O2 and a molecular weight of 387.28 g/mol. Its IUPAC name is N-benzyl-3-bromo-N-(2-cyanoethyl)-4-ethoxybenzamide.
| Compound Name | N-benzyl-3-bromo-N-(2-cyanoethyl)-4-ethoxybenzamide |
|---|---|
| PubChem CID | 43911773 |
| Molecular Formula | C19H19BrN2O2 |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | N-benzyl-3-bromo-N-(2-cyanoethyl)-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N(CCC#N)Cc2ccccc2)cc1Br |
| InChI | InChI=1S/C19H19BrN2O2/c1-2-24-18-10-9-16(13-17(18)20)19(23)22(12-6-11-21)14-15-7-4-3-5-8-15/h3-5,7-10,13H,2,6,12,14H2,1H3 |
| InChIKey | NFMSIYGPARKWRW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |