C19H20N2O2 — CID 43911736
N-benzyl-N-(2-cyanoethyl)-3-ethoxybenzamide (PubChem CID 43911736) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is N-benzyl-N-(2-cyanoethyl)-3-ethoxybenzamide.
| Compound Name | N-benzyl-N-(2-cyanoethyl)-3-ethoxybenzamide |
|---|---|
| PubChem CID | 43911736 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | N-benzyl-N-(2-cyanoethyl)-3-ethoxybenzamide |
| SMILES | CCOc1cccc(C(=O)N(CCC#N)Cc2ccccc2)c1 |
| InChI | InChI=1S/C19H20N2O2/c1-2-23-18-11-6-10-17(14-18)19(22)21(13-7-12-20)15-16-8-4-3-5-9-16/h3-6,8-11,14H,2,7,13,15H2,1H3 |
| InChIKey | ZEGUJXXKWTXGMQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |