C22H26N2O2 — CID 54790506
3-butoxy-N-(2-cyanoethyl)-N-(2-phenylethyl)benzamide (PubChem CID 54790506) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 3-butoxy-N-(2-cyanoethyl)-N-(2-phenylethyl)benzamide.
| Compound Name | 3-butoxy-N-(2-cyanoethyl)-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 54790506 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 3-butoxy-N-(2-cyanoethyl)-N-(2-phenylethyl)benzamide |
| SMILES | CCCCOc1cccc(C(=O)N(CCC#N)CCc2ccccc2)c1 |
| InChI | InChI=1S/C22H26N2O2/c1-2-3-17-26-21-12-7-11-20(18-21)22(25)24(15-8-14-23)16-13-19-9-5-4-6-10-19/h4-7,9-12,18H,2-3,8,13,15-17H2,1H3 |
| InChIKey | LLOYGBPHIPCPFG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|