C27H27N3O2S — CID 54790667
N-[2-cyanoethyl(2-phenylethyl)carbamothioyl]-3-(2-phenylethoxy)benzamide (PubChem CID 54790667) has the molecular formula C27H27N3O2S and a molecular weight of 457.60 g/mol. Its IUPAC name is N-[2-cyanoethyl(2-phenylethyl)carbamothioyl]-3-(2-phenylethoxy)benzamide.
| Compound Name | N-[2-cyanoethyl(2-phenylethyl)carbamothioyl]-3-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 54790667 |
| Molecular Formula | C27H27N3O2S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | N-[2-cyanoethyl(2-phenylethyl)carbamothioyl]-3-(2-phenylethoxy)benzamide |
| SMILES | N#CCCN(CCc1ccccc1)C(=S)NC(=O)c1cccc(OCCc2ccccc2)c1 |
| InChI | InChI=1S/C27H27N3O2S/c28-17-8-18-30(19-15-22-9-3-1-4-10-22)27(33)29-26(31)24-13-7-14-25(21-24)32-20-16-23-11-5-2-6-12-23/h1-7,9-14,21H,8,15-16,18-20H2,(H,29,31,33) |
| InChIKey | QJXIUTAQQKDTDB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|