C30H27N3O4S — CID 17134886
3-(2-phenylethoxy)-N-[[(4-phenylmethoxybenzoyl)amino]carbamothioyl]benzamide (PubChem CID 17134886) has the molecular formula C30H27N3O4S and a molecular weight of 525.63 g/mol. Its IUPAC name is 3-(2-phenylethoxy)-N-[[(4-phenylmethoxybenzoyl)amino]carbamothioyl]benzamide.
| Compound Name | 3-(2-phenylethoxy)-N-[[(4-phenylmethoxybenzoyl)amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17134886 |
| Molecular Formula | C30H27N3O4S |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | 3-(2-phenylethoxy)-N-[[(4-phenylmethoxybenzoyl)amino]carbamothioyl]benzamide |
| SMILES | O=C(NNC(=S)NC(=O)c1cccc(OCCc2ccccc2)c1)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H27N3O4S/c34-28(25-12-7-13-27(20-25)36-19-18-22-8-3-1-4-9-22)31-30(38)33-32-29(35)24-14-16-26(17-15-24)37-21-23-10-5-2-6-11-23/h1-17,20H,18-19,21H2,(H,32,35)(H2,31,33,34,38) |
| InChIKey | RGURLZJEKFOXPC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|