C24H22BrN3O4S — CID 17134842
N-[[[2-(4-bromophenoxy)acetyl]amino]carbamothioyl]-3-(2-phenylethoxy)benzamide (PubChem CID 17134842) has the molecular formula C24H22BrN3O4S and a molecular weight of 528.43 g/mol. Its IUPAC name is N-[[[2-(4-bromophenoxy)acetyl]amino]carbamothioyl]-3-(2-phenylethoxy)benzamide.
| Compound Name | N-[[[2-(4-bromophenoxy)acetyl]amino]carbamothioyl]-3-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 17134842 |
| Molecular Formula | C24H22BrN3O4S |
| Molecular Weight | 528.43 g/mol |
| Exact Mass | 527.05 |
| IUPAC Name | N-[[[2-(4-bromophenoxy)acetyl]amino]carbamothioyl]-3-(2-phenylethoxy)benzamide |
| SMILES | O=C(COc1ccc(Br)cc1)NNC(=S)NC(=O)c1cccc(OCCc2ccccc2)c1 |
| InChI | InChI=1S/C24H22BrN3O4S/c25-19-9-11-20(12-10-19)32-16-22(29)27-28-24(33)26-23(30)18-7-4-8-21(15-18)31-14-13-17-5-2-1-3-6-17/h1-12,15H,13-14,16H2,(H,27,29)(H2,26,28,30,33) |
| InChIKey | HLDXLXSZPINHIS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|