C26H26BrN3O5S — CID 4955443
N-[[[2-(2-bromo-4-ethylphenoxy)acetyl]amino]carbamothioyl]-3-(2-phenoxyethoxy)benzamide (PubChem CID 4955443) has the molecular formula C26H26BrN3O5S and a molecular weight of 572.48 g/mol. Its IUPAC name is N-[[[2-(2-bromo-4-ethylphenoxy)acetyl]amino]carbamothioyl]-3-(2-phenoxyethoxy)benzamide.
| Compound Name | N-[[[2-(2-bromo-4-ethylphenoxy)acetyl]amino]carbamothioyl]-3-(2-phenoxyethoxy)benzamide |
|---|---|
| PubChem CID | 4955443 |
| Molecular Formula | C26H26BrN3O5S |
| Molecular Weight | 572.48 g/mol |
| Exact Mass | 571.08 |
| IUPAC Name | N-[[[2-(2-bromo-4-ethylphenoxy)acetyl]amino]carbamothioyl]-3-(2-phenoxyethoxy)benzamide |
| SMILES | CCc1ccc(OCC(=O)NNC(=S)NC(=O)c2cccc(OCCOc3ccccc3)c2)c(Br)c1 |
| InChI | InChI=1S/C26H26BrN3O5S/c1-2-18-11-12-23(22(27)15-18)35-17-24(31)29-30-26(36)28-25(32)19-7-6-10-21(16-19)34-14-13-33-20-8-4-3-5-9-20/h3-12,15-16H,2,13-14,17H2,1H3,(H,29,31)(H2,28,30,32,36) |
| InChIKey | IRRJPBVMMVAKIQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|