C19H19BrN2O5 — CID 17175455
methyl 3-[[[2-(2-bromo-4-ethylphenoxy)acetyl]amino]carbamoyl]benzoate (PubChem CID 17175455) has the molecular formula C19H19BrN2O5 and a molecular weight of 435.27 g/mol. Its IUPAC name is methyl 3-[[[2-(2-bromo-4-ethylphenoxy)acetyl]amino]carbamoyl]benzoate.
| Compound Name | methyl 3-[[[2-(2-bromo-4-ethylphenoxy)acetyl]amino]carbamoyl]benzoate |
|---|---|
| PubChem CID | 17175455 |
| Molecular Formula | C19H19BrN2O5 |
| Molecular Weight | 435.27 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | methyl 3-[[[2-(2-bromo-4-ethylphenoxy)acetyl]amino]carbamoyl]benzoate |
| SMILES | CCc1ccc(OCC(=O)NNC(=O)c2cccc(C(=O)OC)c2)c(Br)c1 |
| InChI | InChI=1S/C19H19BrN2O5/c1-3-12-7-8-16(15(20)9-12)27-11-17(23)21-22-18(24)13-5-4-6-14(10-13)19(25)26-2/h4-10H,3,11H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | FRCPOQFLUAUDLA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|