C19H20N2O5 — CID 17175383
methyl 3-[[[2-(2,4-dimethylphenoxy)acetyl]amino]carbamoyl]benzoate (PubChem CID 17175383) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is methyl 3-[[[2-(2,4-dimethylphenoxy)acetyl]amino]carbamoyl]benzoate.
| Compound Name | methyl 3-[[[2-(2,4-dimethylphenoxy)acetyl]amino]carbamoyl]benzoate |
|---|---|
| PubChem CID | 17175383 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | methyl 3-[[[2-(2,4-dimethylphenoxy)acetyl]amino]carbamoyl]benzoate |
| SMILES | COC(=O)c1cccc(C(=O)NNC(=O)COc2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C19H20N2O5/c1-12-7-8-16(13(2)9-12)26-11-17(22)20-21-18(23)14-5-4-6-15(10-14)19(24)25-3/h4-10H,11H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | BLUBDLFSRFVYQD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|