C21H25BrN2O3 — CID 4500815
3-bromo-4-tert-butyl-N'-[2-(2,4-dimethylphenoxy)acetyl]benzohydrazide (PubChem CID 4500815) has the molecular formula C21H25BrN2O3 and a molecular weight of 433.35 g/mol. Its IUPAC name is 3-bromo-4-tert-butyl-N'-[2-(2,4-dimethylphenoxy)acetyl]benzohydrazide.
| Compound Name | 3-bromo-4-tert-butyl-N'-[2-(2,4-dimethylphenoxy)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 4500815 |
| Molecular Formula | C21H25BrN2O3 |
| Molecular Weight | 433.35 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 3-bromo-4-tert-butyl-N'-[2-(2,4-dimethylphenoxy)acetyl]benzohydrazide |
| SMILES | Cc1ccc(OCC(=O)NNC(=O)c2ccc(C(C)(C)C)c(Br)c2)c(C)c1 |
| InChI | InChI=1S/C21H25BrN2O3/c1-13-6-9-18(14(2)10-13)27-12-19(25)23-24-20(26)15-7-8-16(17(22)11-15)21(3,4)5/h6-11H,12H2,1-5H3,(H,23,25)(H,24,26) |
| InChIKey | NHGQCADLXISPCH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|