C20H23BrN2O3 — CID 1047378
N'-[2-(4-bromo-2-methylphenoxy)acetyl]-4-tert-butylbenzohydrazide (PubChem CID 1047378) has the molecular formula C20H23BrN2O3 and a molecular weight of 419.32 g/mol. Its IUPAC name is N'-[2-(4-bromo-2-methylphenoxy)acetyl]-4-tert-butylbenzohydrazide.
| Compound Name | N'-[2-(4-bromo-2-methylphenoxy)acetyl]-4-tert-butylbenzohydrazide |
|---|---|
| PubChem CID | 1047378 |
| Molecular Formula | C20H23BrN2O3 |
| Molecular Weight | 419.32 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | N'-[2-(4-bromo-2-methylphenoxy)acetyl]-4-tert-butylbenzohydrazide |
| SMILES | Cc1cc(Br)ccc1OCC(=O)NNC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H23BrN2O3/c1-13-11-16(21)9-10-17(13)26-12-18(24)22-23-19(25)14-5-7-15(8-6-14)20(2,3)4/h5-11H,12H2,1-4H3,(H,22,24)(H,23,25) |
| InChIKey | GDDITZCEZGXSPG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.32 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|