C30H27Br2N3O4 — CID 3380438
4-tert-butyl-N-[4-[[[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]amino]carbamoyl]phenyl]benzamide (PubChem CID 3380438) has the molecular formula C30H27Br2N3O4 and a molecular weight of 653.37 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-[[[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]amino]carbamoyl]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[4-[[[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]amino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 3380438 |
| Molecular Formula | C30H27Br2N3O4 |
| Molecular Weight | 653.37 g/mol |
| Exact Mass | 651.04 |
| IUPAC Name | 4-tert-butyl-N-[4-[[[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]amino]carbamoyl]phenyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2ccc(C(=O)NNC(=O)COc3ccc4cc(Br)ccc4c3Br)cc2)cc1 |
| InChI | InChI=1S/C30H27Br2N3O4/c1-30(2,3)21-9-4-18(5-10-21)28(37)33-23-12-6-19(7-13-23)29(38)35-34-26(36)17-39-25-15-8-20-16-22(31)11-14-24(20)27(25)32/h4-16H,17H2,1-3H3,(H,33,37)(H,34,36)(H,35,38) |
| InChIKey | RFGQHUCKOSTNJZ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.37 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|