C19H14Br2N2O3S — CID 5120117
2-(1,6-dibromonaphthalen-2-yl)oxy-N-[(4-hydroxyphenyl)carbamothioyl]acetamide (PubChem CID 5120117) has the molecular formula C19H14Br2N2O3S and a molecular weight of 510.21 g/mol. Its IUPAC name is 2-(1,6-dibromonaphthalen-2-yl)oxy-N-[(4-hydroxyphenyl)carbamothioyl]acetamide.
| Compound Name | 2-(1,6-dibromonaphthalen-2-yl)oxy-N-[(4-hydroxyphenyl)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 5120117 |
| Molecular Formula | C19H14Br2N2O3S |
| Molecular Weight | 510.21 g/mol |
| Exact Mass | 507.91 |
| IUPAC Name | 2-(1,6-dibromonaphthalen-2-yl)oxy-N-[(4-hydroxyphenyl)carbamothioyl]acetamide |
| SMILES | O=C(COc1ccc2cc(Br)ccc2c1Br)NC(=S)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C19H14Br2N2O3S/c20-12-2-7-15-11(9-12)1-8-16(18(15)21)26-10-17(25)23-19(27)22-13-3-5-14(24)6-4-13/h1-9,24H,10H2,(H2,22,23,25,27) |
| InChIKey | NSUGFYHODMIPMM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.21 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|