C19H15Br2NO3 — CID 3326030
2-(1,6-dibromonaphthalen-2-yl)oxy-N-(4-methoxyphenyl)acetamide (PubChem CID 3326030) has the molecular formula C19H15Br2NO3 and a molecular weight of 465.14 g/mol. Its IUPAC name is 2-(1,6-dibromonaphthalen-2-yl)oxy-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-(1,6-dibromonaphthalen-2-yl)oxy-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 3326030 |
| Molecular Formula | C19H15Br2NO3 |
| Molecular Weight | 465.14 g/mol |
| Exact Mass | 462.94 |
| IUPAC Name | 2-(1,6-dibromonaphthalen-2-yl)oxy-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)COc2ccc3cc(Br)ccc3c2Br)cc1 |
| InChI | InChI=1S/C19H15Br2NO3/c1-24-15-6-4-14(5-7-15)22-18(23)11-25-17-9-2-12-10-13(20)3-8-16(12)19(17)21/h2-10H,11H2,1H3,(H,22,23) |
| InChIKey | RJCXRNMJORTUIS-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.14 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |