C19H14Br2O4 — CID 3454697
(4-methoxyphenyl) 2-(1,6-dibromonaphthalen-2-yl)oxyacetate (PubChem CID 3454697) has the molecular formula C19H14Br2O4 and a molecular weight of 466.13 g/mol. Its IUPAC name is (4-methoxyphenyl) 2-(1,6-dibromonaphthalen-2-yl)oxyacetate.
| Compound Name | (4-methoxyphenyl) 2-(1,6-dibromonaphthalen-2-yl)oxyacetate |
|---|---|
| PubChem CID | 3454697 |
| Molecular Formula | C19H14Br2O4 |
| Molecular Weight | 466.13 g/mol |
| Exact Mass | 463.93 |
| IUPAC Name | (4-methoxyphenyl) 2-(1,6-dibromonaphthalen-2-yl)oxyacetate |
| SMILES | COc1ccc(OC(=O)COc2ccc3cc(Br)ccc3c2Br)cc1 |
| InChI | InChI=1S/C19H14Br2O4/c1-23-14-4-6-15(7-5-14)25-18(22)11-24-17-9-2-12-10-13(20)3-8-16(12)19(17)21/h2-10H,11H2,1H3 |
| InChIKey | MRMLMZGPNJNKLB-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.13 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|