C16H15Br2NO2 — CID 3330511
2-(1,6-dibromonaphthalen-2-yl)oxy-1-pyrrolidin-1-ylethanone (PubChem CID 3330511) has the molecular formula C16H15Br2NO2 and a molecular weight of 413.11 g/mol. Its IUPAC name is 2-(1,6-dibromonaphthalen-2-yl)oxy-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-(1,6-dibromonaphthalen-2-yl)oxy-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 3330511 |
| Molecular Formula | C16H15Br2NO2 |
| Molecular Weight | 413.11 g/mol |
| Exact Mass | 410.95 |
| IUPAC Name | 2-(1,6-dibromonaphthalen-2-yl)oxy-1-pyrrolidin-1-ylethanone |
| SMILES | O=C(COc1ccc2cc(Br)ccc2c1Br)N1CCCC1 |
| InChI | InChI=1S/C16H15Br2NO2/c17-12-4-5-13-11(9-12)3-6-14(16(13)18)21-10-15(20)19-7-1-2-8-19/h3-6,9H,1-2,7-8,10H2 |
| InChIKey | WUBJDLMHNUDRHZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.11 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |