C22H19Br2N3O5S — CID 3307662
N-[[[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]amino]carbamothioyl]-2-(4-methoxyphenoxy)acetamide (PubChem CID 3307662) has the molecular formula C22H19Br2N3O5S and a molecular weight of 597.29 g/mol. Its IUPAC name is N-[[[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]amino]carbamothioyl]-2-(4-methoxyphenoxy)acetamide.
| Compound Name | N-[[[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]amino]carbamothioyl]-2-(4-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 3307662 |
| Molecular Formula | C22H19Br2N3O5S |
| Molecular Weight | 597.29 g/mol |
| Exact Mass | 594.94 |
| IUPAC Name | N-[[[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]amino]carbamothioyl]-2-(4-methoxyphenoxy)acetamide |
| SMILES | COc1ccc(OCC(=O)NC(=S)NNC(=O)COc2ccc3cc(Br)ccc3c2Br)cc1 |
| InChI | InChI=1S/C22H19Br2N3O5S/c1-30-15-4-6-16(7-5-15)31-11-19(28)25-22(33)27-26-20(29)12-32-18-9-2-13-10-14(23)3-8-17(13)21(18)24/h2-10H,11-12H2,1H3,(H,26,29)(H2,25,27,28,33) |
| InChIKey | HVLGMNRPCQTOSD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.29 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|