C19H12Br3ClN2O2S — CID 5208760
N-[(4-bromo-3-chlorophenyl)carbamothioyl]-2-(1,6-dibromonaphthalen-2-yl)oxyacetamide (PubChem CID 5208760) has the molecular formula C19H12Br3ClN2O2S and a molecular weight of 607.55 g/mol. Its IUPAC name is N-[(4-bromo-3-chlorophenyl)carbamothioyl]-2-(1,6-dibromonaphthalen-2-yl)oxyacetamide.
| Compound Name | N-[(4-bromo-3-chlorophenyl)carbamothioyl]-2-(1,6-dibromonaphthalen-2-yl)oxyacetamide |
|---|---|
| PubChem CID | 5208760 |
| Molecular Formula | C19H12Br3ClN2O2S |
| Molecular Weight | 607.55 g/mol |
| Exact Mass | 603.79 |
| IUPAC Name | N-[(4-bromo-3-chlorophenyl)carbamothioyl]-2-(1,6-dibromonaphthalen-2-yl)oxyacetamide |
| SMILES | O=C(COc1ccc2cc(Br)ccc2c1Br)NC(=S)Nc1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C19H12Br3ClN2O2S/c20-11-2-4-13-10(7-11)1-6-16(18(13)22)27-9-17(26)25-19(28)24-12-3-5-14(21)15(23)8-12/h1-8H,9H2,(H2,24,25,26,28) |
| InChIKey | SLOZRQDROSNXEY-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.55 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|