C18H11Br2Cl2NO2 — CID 3380159
2-(1,6-dibromonaphthalen-2-yl)oxy-N-(2,4-dichlorophenyl)acetamide (PubChem CID 3380159) has the molecular formula C18H11Br2Cl2NO2 and a molecular weight of 504.01 g/mol. Its IUPAC name is 2-(1,6-dibromonaphthalen-2-yl)oxy-N-(2,4-dichlorophenyl)acetamide.
| Compound Name | 2-(1,6-dibromonaphthalen-2-yl)oxy-N-(2,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 3380159 |
| Molecular Formula | C18H11Br2Cl2NO2 |
| Molecular Weight | 504.01 g/mol |
| Exact Mass | 500.85 |
| IUPAC Name | 2-(1,6-dibromonaphthalen-2-yl)oxy-N-(2,4-dichlorophenyl)acetamide |
| SMILES | O=C(COc1ccc2cc(Br)ccc2c1Br)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H11Br2Cl2NO2/c19-11-2-4-13-10(7-11)1-6-16(18(13)20)25-9-17(24)23-15-5-3-12(21)8-14(15)22/h1-8H,9H2,(H,23,24) |
| InChIKey | ZLFTVCUOIRNCTB-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.01 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |