C21H17BrCl2N2O4 — CID 4729784
2-(6-bromo-2-methoxynaphthalen-1-yl)-N'-[2-(2,4-dichlorophenoxy)acetyl]acetohydrazide (PubChem CID 4729784) has the molecular formula C21H17BrCl2N2O4 and a molecular weight of 512.19 g/mol. Its IUPAC name is 2-(6-bromo-2-methoxynaphthalen-1-yl)-N'-[2-(2,4-dichlorophenoxy)acetyl]acetohydrazide.
| Compound Name | 2-(6-bromo-2-methoxynaphthalen-1-yl)-N'-[2-(2,4-dichlorophenoxy)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 4729784 |
| Molecular Formula | C21H17BrCl2N2O4 |
| Molecular Weight | 512.19 g/mol |
| Exact Mass | 509.97 |
| IUPAC Name | 2-(6-bromo-2-methoxynaphthalen-1-yl)-N'-[2-(2,4-dichlorophenoxy)acetyl]acetohydrazide |
| SMILES | COc1ccc2cc(Br)ccc2c1CC(=O)NNC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H17BrCl2N2O4/c1-29-18-6-2-12-8-13(22)3-5-15(12)16(18)10-20(27)25-26-21(28)11-30-19-7-4-14(23)9-17(19)24/h2-9H,10-11H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | NBJQEUHQEHERRK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.19 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|