C18H18Cl2N2O6 — CID 2818575
N'-[2-(2,4-dichlorophenoxy)acetyl]-3,4,5-trimethoxybenzohydrazide (PubChem CID 2818575) has the molecular formula C18H18Cl2N2O6 and a molecular weight of 429.26 g/mol. Its IUPAC name is N'-[2-(2,4-dichlorophenoxy)acetyl]-3,4,5-trimethoxybenzohydrazide.
| Compound Name | N'-[2-(2,4-dichlorophenoxy)acetyl]-3,4,5-trimethoxybenzohydrazide |
|---|---|
| PubChem CID | 2818575 |
| Molecular Formula | C18H18Cl2N2O6 |
| Molecular Weight | 429.26 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | N'-[2-(2,4-dichlorophenoxy)acetyl]-3,4,5-trimethoxybenzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)COc2ccc(Cl)cc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C18H18Cl2N2O6/c1-25-14-6-10(7-15(26-2)17(14)27-3)18(24)22-21-16(23)9-28-13-5-4-11(19)8-12(13)20/h4-8H,9H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | BLWRVILPBMYPIS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|