C17H16ClFN2O5 — CID 9084627
N'-(4-chloro-2-fluorobenzoyl)-3,4,5-trimethoxybenzohydrazide (PubChem CID 9084627) has the molecular formula C17H16ClFN2O5 and a molecular weight of 382.78 g/mol. Its IUPAC name is N'-(4-chloro-2-fluorobenzoyl)-3,4,5-trimethoxybenzohydrazide.
| Compound Name | N'-(4-chloro-2-fluorobenzoyl)-3,4,5-trimethoxybenzohydrazide |
|---|---|
| PubChem CID | 9084627 |
| Molecular Formula | C17H16ClFN2O5 |
| Molecular Weight | 382.78 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | N'-(4-chloro-2-fluorobenzoyl)-3,4,5-trimethoxybenzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)c2ccc(Cl)cc2F)cc(OC)c1OC |
| InChI | InChI=1S/C17H16ClFN2O5/c1-24-13-6-9(7-14(25-2)15(13)26-3)16(22)20-21-17(23)11-5-4-10(18)8-12(11)19/h4-8H,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | LWDYUOJUDAPOBS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.78 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|