C18H19ClN2O6 — CID 4805458
N'-(5-chloro-2-methoxybenzoyl)-3,4,5-trimethoxybenzohydrazide (PubChem CID 4805458) has the molecular formula C18H19ClN2O6 and a molecular weight of 394.81 g/mol. Its IUPAC name is N'-(5-chloro-2-methoxybenzoyl)-3,4,5-trimethoxybenzohydrazide.
| Compound Name | N'-(5-chloro-2-methoxybenzoyl)-3,4,5-trimethoxybenzohydrazide |
|---|---|
| PubChem CID | 4805458 |
| Molecular Formula | C18H19ClN2O6 |
| Molecular Weight | 394.81 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | N'-(5-chloro-2-methoxybenzoyl)-3,4,5-trimethoxybenzohydrazide |
| SMILES | COc1ccc(Cl)cc1C(=O)NNC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C18H19ClN2O6/c1-24-13-6-5-11(19)9-12(13)18(23)21-20-17(22)10-7-14(25-2)16(27-4)15(8-10)26-3/h5-9H,1-4H3,(H,20,22)(H,21,23) |
| InChIKey | OIUMNRZYUOSOPB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.81 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|