C15H11Cl2IN2O3 — CID 39708070
5-chloro-N'-(5-chloro-2-iodobenzoyl)-2-methoxybenzohydrazide (PubChem CID 39708070) has the molecular formula C15H11Cl2IN2O3 and a molecular weight of 465.07 g/mol. Its IUPAC name is 5-chloro-N'-(5-chloro-2-iodobenzoyl)-2-methoxybenzohydrazide.
| Compound Name | 5-chloro-N'-(5-chloro-2-iodobenzoyl)-2-methoxybenzohydrazide |
|---|---|
| PubChem CID | 39708070 |
| Molecular Formula | C15H11Cl2IN2O3 |
| Molecular Weight | 465.07 g/mol |
| Exact Mass | 463.92 |
| IUPAC Name | 5-chloro-N'-(5-chloro-2-iodobenzoyl)-2-methoxybenzohydrazide |
| SMILES | COc1ccc(Cl)cc1C(=O)NNC(=O)c1cc(Cl)ccc1I |
| InChI | InChI=1S/C15H11Cl2IN2O3/c1-23-13-5-3-9(17)7-11(13)15(22)20-19-14(21)10-6-8(16)2-4-12(10)18/h2-7H,1H3,(H,19,21)(H,20,22) |
| InChIKey | ILEZJFDKRPOPFA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.07 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|