C16H14ClIN2O4 — CID 39714334
N'-(4-chloro-2-iodobenzoyl)-3,4-dimethoxybenzohydrazide (PubChem CID 39714334) has the molecular formula C16H14ClIN2O4 and a molecular weight of 460.66 g/mol. Its IUPAC name is N'-(4-chloro-2-iodobenzoyl)-3,4-dimethoxybenzohydrazide.
| Compound Name | N'-(4-chloro-2-iodobenzoyl)-3,4-dimethoxybenzohydrazide |
|---|---|
| PubChem CID | 39714334 |
| Molecular Formula | C16H14ClIN2O4 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 459.97 |
| IUPAC Name | N'-(4-chloro-2-iodobenzoyl)-3,4-dimethoxybenzohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)c2ccc(Cl)cc2I)cc1OC |
| InChI | InChI=1S/C16H14ClIN2O4/c1-23-13-6-3-9(7-14(13)24-2)15(21)19-20-16(22)11-5-4-10(17)8-12(11)18/h3-8H,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | XBKHPHGPPDONIV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|