C18H16Cl2N2O6 — CID 55313953
[2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 2,5-dichlorobenzoate (PubChem CID 55313953) has the molecular formula C18H16Cl2N2O6 and a molecular weight of 427.24 g/mol. Its IUPAC name is [2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 2,5-dichlorobenzoate.
| Compound Name | [2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 2,5-dichlorobenzoate |
|---|---|
| PubChem CID | 55313953 |
| Molecular Formula | C18H16Cl2N2O6 |
| Molecular Weight | 427.24 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | [2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 2,5-dichlorobenzoate |
| SMILES | COc1ccc(C(=O)NNC(=O)COC(=O)c2cc(Cl)ccc2Cl)cc1OC |
| InChI | InChI=1S/C18H16Cl2N2O6/c1-26-14-6-3-10(7-15(14)27-2)17(24)22-21-16(23)9-28-18(25)12-8-11(19)4-5-13(12)20/h3-8H,9H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | XEHBNLDOZYOWFE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.24 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|