C18H18ClN3O8S — CID 16518351
[2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-methoxy-5-sulfamoylbenzoate (PubChem CID 16518351) has the molecular formula C18H18ClN3O8S and a molecular weight of 471.88 g/mol. Its IUPAC name is [2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-methoxy-5-sulfamoylbenzoate.
| Compound Name | [2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-methoxy-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 16518351 |
| Molecular Formula | C18H18ClN3O8S |
| Molecular Weight | 471.88 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | [2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-methoxy-5-sulfamoylbenzoate |
| SMILES | COc1ccc(Cl)cc1C(=O)NNC(=O)COC(=O)c1cc(S(N)(=O)=O)ccc1OC |
| InChI | InChI=1S/C18H18ClN3O8S/c1-28-14-5-3-10(19)7-12(14)17(24)22-21-16(23)9-30-18(25)13-8-11(31(20,26)27)4-6-15(13)29-2/h3-8H,9H2,1-2H3,(H,21,23)(H,22,24)(H2,20,26,27) |
| InChIKey | VTYPRSHIXTUAIK-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 163.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.88 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|