C17H14ClF3N2O6S — CID 16518470
[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 2-methoxy-5-sulfamoylbenzoate (PubChem CID 16518470) has the molecular formula C17H14ClF3N2O6S and a molecular weight of 466.82 g/mol. Its IUPAC name is [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 2-methoxy-5-sulfamoylbenzoate.
| Compound Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 2-methoxy-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 16518470 |
| Molecular Formula | C17H14ClF3N2O6S |
| Molecular Weight | 466.82 g/mol |
| Exact Mass | 466.02 |
| IUPAC Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 2-methoxy-5-sulfamoylbenzoate |
| SMILES | COc1ccc(S(N)(=O)=O)cc1C(=O)OCC(=O)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C17H14ClF3N2O6S/c1-28-14-5-3-10(30(22,26)27)7-11(14)16(25)29-8-15(24)23-13-4-2-9(18)6-12(13)17(19,20)21/h2-7H,8H2,1H3,(H,23,24)(H2,22,26,27) |
| InChIKey | RTYQFIRJBUMGDY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.82 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |