C17H13Cl2F3N2O4 — CID 2367730
[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate (PubChem CID 2367730) has the molecular formula C17H13Cl2F3N2O4 and a molecular weight of 437.20 g/mol. Its IUPAC name is [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate.
| Compound Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 2367730 |
| Molecular Formula | C17H13Cl2F3N2O4 |
| Molecular Weight | 437.20 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)OCC(=O)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C17H13Cl2F3N2O4/c1-27-14-6-12(23)11(19)5-9(14)16(26)28-7-15(25)24-13-3-2-8(18)4-10(13)17(20,21)22/h2-6H,7,23H2,1H3,(H,24,25) |
| InChIKey | BIITYBQBPXVFHC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.20 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|