C17H15ClFN3O5 — CID 7826073
[2-[(2-fluorophenyl)carbamoylamino]-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate (PubChem CID 7826073) has the molecular formula C17H15ClFN3O5 and a molecular weight of 395.77 g/mol. Its IUPAC name is [2-[(2-fluorophenyl)carbamoylamino]-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate.
| Compound Name | [2-[(2-fluorophenyl)carbamoylamino]-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 7826073 |
| Molecular Formula | C17H15ClFN3O5 |
| Molecular Weight | 395.77 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | [2-[(2-fluorophenyl)carbamoylamino]-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)OCC(=O)NC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C17H15ClFN3O5/c1-26-14-7-12(20)10(18)6-9(14)16(24)27-8-15(23)22-17(25)21-13-5-3-2-4-11(13)19/h2-7H,8,20H2,1H3,(H2,21,22,23,25) |
| InChIKey | UIERLMFGTYOBQF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.77 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|