C17H14Cl2F2N2O5 — CID 16529519
[2-[3-chloro-4-(difluoromethoxy)anilino]-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate (PubChem CID 16529519) has the molecular formula C17H14Cl2F2N2O5 and a molecular weight of 435.21 g/mol. Its IUPAC name is [2-[3-chloro-4-(difluoromethoxy)anilino]-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate.
| Compound Name | [2-[3-chloro-4-(difluoromethoxy)anilino]-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 16529519 |
| Molecular Formula | C17H14Cl2F2N2O5 |
| Molecular Weight | 435.21 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | [2-[3-chloro-4-(difluoromethoxy)anilino]-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)OCC(=O)Nc1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C17H14Cl2F2N2O5/c1-26-14-6-12(22)10(18)5-9(14)16(25)27-7-15(24)23-8-2-3-13(11(19)4-8)28-17(20)21/h2-6,17H,7,22H2,1H3,(H,23,24) |
| InChIKey | SYICROAULDKOEQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.21 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|