C17H15ClF2N2O5 — CID 2570506
[2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate (PubChem CID 2570506) has the molecular formula C17H15ClF2N2O5 and a molecular weight of 400.77 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate.
| Compound Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 2570506 |
| Molecular Formula | C17H15ClF2N2O5 |
| Molecular Weight | 400.77 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)OCC(=O)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H15ClF2N2O5/c1-25-14-7-13(21)12(18)6-11(14)16(24)26-8-15(23)22-9-2-4-10(5-3-9)27-17(19)20/h2-7,17H,8,21H2,1H3,(H,22,23) |
| InChIKey | FWDKPDOFPXHPBU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.77 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|