C20H22N2O7 — CID 2566522
[2-(4-acetamidoanilino)-2-oxoethyl] 2,4,5-trimethoxybenzoate (PubChem CID 2566522) has the molecular formula C20H22N2O7 and a molecular weight of 402.40 g/mol. Its IUPAC name is [2-(4-acetamidoanilino)-2-oxoethyl] 2,4,5-trimethoxybenzoate.
| Compound Name | [2-(4-acetamidoanilino)-2-oxoethyl] 2,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 2566522 |
| Molecular Formula | C20H22N2O7 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | [2-(4-acetamidoanilino)-2-oxoethyl] 2,4,5-trimethoxybenzoate |
| SMILES | COc1cc(OC)c(C(=O)OCC(=O)Nc2ccc(NC(C)=O)cc2)cc1OC |
| InChI | InChI=1S/C20H22N2O7/c1-12(23)21-13-5-7-14(8-6-13)22-19(24)11-29-20(25)15-9-17(27-3)18(28-4)10-16(15)26-2/h5-10H,11H2,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | DROIQVCYIXUITM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |