C24H27NO10 — CID 3572922
diethyl 5-[[2-(2,4,5-trimethoxybenzoyl)oxyacetyl]amino]benzene-1,3-dicarboxylate (PubChem CID 3572922) has the molecular formula C24H27NO10 and a molecular weight of 489.48 g/mol. Its IUPAC name is diethyl 5-[[2-(2,4,5-trimethoxybenzoyl)oxyacetyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | diethyl 5-[[2-(2,4,5-trimethoxybenzoyl)oxyacetyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 3572922 |
| Molecular Formula | C24H27NO10 |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | diethyl 5-[[2-(2,4,5-trimethoxybenzoyl)oxyacetyl]amino]benzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc(NC(=O)COC(=O)c2cc(OC)c(OC)cc2OC)cc(C(=O)OCC)c1 |
| InChI | InChI=1S/C24H27NO10/c1-6-33-22(27)14-8-15(23(28)34-7-2)10-16(9-14)25-21(26)13-35-24(29)17-11-19(31-4)20(32-5)12-18(17)30-3/h8-12H,6-7,13H2,1-5H3,(H,25,26) |
| InChIKey | PCCSCJOSUNJVPN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|