C18H20N2O8S — CID 55316135
[2-oxo-2-(4-sulfamoylanilino)ethyl] 2,4,5-trimethoxybenzoate (PubChem CID 55316135) has the molecular formula C18H20N2O8S and a molecular weight of 424.43 g/mol. Its IUPAC name is [2-oxo-2-(4-sulfamoylanilino)ethyl] 2,4,5-trimethoxybenzoate.
| Compound Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 2,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 55316135 |
| Molecular Formula | C18H20N2O8S |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 2,4,5-trimethoxybenzoate |
| SMILES | COc1cc(OC)c(C(=O)OCC(=O)Nc2ccc(S(N)(=O)=O)cc2)cc1OC |
| InChI | InChI=1S/C18H20N2O8S/c1-25-14-9-16(27-3)15(26-2)8-13(14)18(22)28-10-17(21)20-11-4-6-12(7-5-11)29(19,23)24/h4-9H,10H2,1-3H3,(H,20,21)(H2,19,23,24) |
| InChIKey | CZBCCCWOJCRTTI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 143.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |