C22H22ClN3O6S — CID 2387786
[2-oxo-2-(4-sulfamoylanilino)ethyl] 1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxylate (PubChem CID 2387786) has the molecular formula C22H22ClN3O6S and a molecular weight of 491.95 g/mol. Its IUPAC name is [2-oxo-2-(4-sulfamoylanilino)ethyl] 1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxylate.
| Compound Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 2387786 |
| Molecular Formula | C22H22ClN3O6S |
| Molecular Weight | 491.95 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxylate |
| SMILES | COc1ccc(Cl)cc1-n1c(C)cc(C(=O)OCC(=O)Nc2ccc(S(N)(=O)=O)cc2)c1C |
| InChI | InChI=1S/C22H22ClN3O6S/c1-13-10-18(14(2)26(13)19-11-15(23)4-9-20(19)31-3)22(28)32-12-21(27)25-16-5-7-17(8-6-16)33(24,29)30/h4-11H,12H2,1-3H3,(H,25,27)(H2,24,29,30) |
| InChIKey | IJJCJFWBQWOBHN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.95 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|