C16H15FN2O6S — CID 7522974
[2-oxo-2-(4-sulfamoylanilino)ethyl] 3-fluoro-4-methoxybenzoate (PubChem CID 7522974) has the molecular formula C16H15FN2O6S and a molecular weight of 382.37 g/mol. Its IUPAC name is [2-oxo-2-(4-sulfamoylanilino)ethyl] 3-fluoro-4-methoxybenzoate.
| Compound Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 3-fluoro-4-methoxybenzoate |
|---|---|
| PubChem CID | 7522974 |
| Molecular Formula | C16H15FN2O6S |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 3-fluoro-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)Nc2ccc(S(N)(=O)=O)cc2)cc1F |
| InChI | InChI=1S/C16H15FN2O6S/c1-24-14-7-2-10(8-13(14)17)16(21)25-9-15(20)19-11-3-5-12(6-4-11)26(18,22)23/h2-8H,9H2,1H3,(H,19,20)(H2,18,22,23) |
| InChIKey | OAUWKQDRRKHYQW-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |