C19H18N2O9S — CID 55312802
dimethyl 5-[[2-(4-sulfamoylbenzoyl)oxyacetyl]amino]benzene-1,3-dicarboxylate (PubChem CID 55312802) has the molecular formula C19H18N2O9S and a molecular weight of 450.43 g/mol. Its IUPAC name is dimethyl 5-[[2-(4-sulfamoylbenzoyl)oxyacetyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[2-(4-sulfamoylbenzoyl)oxyacetyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 55312802 |
| Molecular Formula | C19H18N2O9S |
| Molecular Weight | 450.43 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | dimethyl 5-[[2-(4-sulfamoylbenzoyl)oxyacetyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)COC(=O)c2ccc(S(N)(=O)=O)cc2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C19H18N2O9S/c1-28-17(23)12-7-13(18(24)29-2)9-14(8-12)21-16(22)10-30-19(25)11-3-5-15(6-4-11)31(20,26)27/h3-9H,10H2,1-2H3,(H,21,22)(H2,20,26,27) |
| InChIKey | FVCXDHCJVLEVFB-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 168.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.43 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|