C17H18N2O6S — CID 38924617
ethyl 4-[2-oxo-2-(4-sulfamoylanilino)ethoxy]benzoate (PubChem CID 38924617) has the molecular formula C17H18N2O6S and a molecular weight of 378.41 g/mol. Its IUPAC name is ethyl 4-[2-oxo-2-(4-sulfamoylanilino)ethoxy]benzoate.
| Compound Name | ethyl 4-[2-oxo-2-(4-sulfamoylanilino)ethoxy]benzoate |
|---|---|
| PubChem CID | 38924617 |
| Molecular Formula | C17H18N2O6S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | ethyl 4-[2-oxo-2-(4-sulfamoylanilino)ethoxy]benzoate |
| SMILES | CCOC(=O)c1ccc(OCC(=O)Nc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C17H18N2O6S/c1-2-24-17(21)12-3-7-14(8-4-12)25-11-16(20)19-13-5-9-15(10-6-13)26(18,22)23/h3-10H,2,11H2,1H3,(H,19,20)(H2,18,22,23) |
| InChIKey | KGBOFTGLXAFZRR-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |