C22H22N2O5S — CID 18870470
2-[4-(3,5-dimethylphenoxy)phenoxy]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 18870470) has the molecular formula C22H22N2O5S and a molecular weight of 426.49 g/mol. Its IUPAC name is 2-[4-(3,5-dimethylphenoxy)phenoxy]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[4-(3,5-dimethylphenoxy)phenoxy]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 18870470 |
| Molecular Formula | C22H22N2O5S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 2-[4-(3,5-dimethylphenoxy)phenoxy]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | Cc1cc(C)cc(Oc2ccc(OCC(=O)Nc3ccc(S(N)(=O)=O)cc3)cc2)c1 |
| InChI | InChI=1S/C22H22N2O5S/c1-15-11-16(2)13-20(12-15)29-19-7-5-18(6-8-19)28-14-22(25)24-17-3-9-21(10-4-17)30(23,26)27/h3-13H,14H2,1-2H3,(H,24,25)(H2,23,26,27) |
| InChIKey | YYAWCSOWABGCJX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |