C28H25NO4 — CID 18870478
2-[4-(3,5-dimethylphenoxy)phenoxy]-N-(4-phenoxyphenyl)acetamide (PubChem CID 18870478) has the molecular formula C28H25NO4 and a molecular weight of 439.51 g/mol. Its IUPAC name is 2-[4-(3,5-dimethylphenoxy)phenoxy]-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2-[4-(3,5-dimethylphenoxy)phenoxy]-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 18870478 |
| Molecular Formula | C28H25NO4 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 2-[4-(3,5-dimethylphenoxy)phenoxy]-N-(4-phenoxyphenyl)acetamide |
| SMILES | Cc1cc(C)cc(Oc2ccc(OCC(=O)Nc3ccc(Oc4ccccc4)cc3)cc2)c1 |
| InChI | InChI=1S/C28H25NO4/c1-20-16-21(2)18-27(17-20)33-26-14-12-23(13-15-26)31-19-28(30)29-22-8-10-25(11-9-22)32-24-6-4-3-5-7-24/h3-18H,19H2,1-2H3,(H,29,30) |
| InChIKey | UYQXQJBCJXVUNP-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |