C18H23N3O6S2 — CID 126212081
2-[4-[[(2R)-butan-2-yl]sulfamoyl]phenoxy]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 126212081) has the molecular formula C18H23N3O6S2 and a molecular weight of 441.53 g/mol. Its IUPAC name is 2-[4-[[(2R)-butan-2-yl]sulfamoyl]phenoxy]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[4-[[(2R)-butan-2-yl]sulfamoyl]phenoxy]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 126212081 |
| Molecular Formula | C18H23N3O6S2 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 2-[4-[[(2R)-butan-2-yl]sulfamoyl]phenoxy]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | CC[C@@H](C)NS(=O)(=O)c1ccc(OCC(=O)Nc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C18H23N3O6S2/c1-3-13(2)21-29(25,26)17-10-6-15(7-11-17)27-12-18(22)20-14-4-8-16(9-5-14)28(19,23)24/h4-11,13,21H,3,12H2,1-2H3,(H,20,22)(H2,19,23,24)/t13-/m1/s1 |
| InChIKey | POEDIACVICFFFX-CYBMUJFWSA-N |
| XLogP | 1.43 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |