C18H21N3O8S2 — CID 55323630
[2-oxo-2-(4-sulfamoylanilino)ethyl] 2-[(4-methoxyphenyl)sulfonylamino]propanoate (PubChem CID 55323630) has the molecular formula C18H21N3O8S2 and a molecular weight of 471.51 g/mol. Its IUPAC name is [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-[(4-methoxyphenyl)sulfonylamino]propanoate.
| Compound Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-[(4-methoxyphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 55323630 |
| Molecular Formula | C18H21N3O8S2 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-[(4-methoxyphenyl)sulfonylamino]propanoate |
| SMILES | COc1ccc(S(=O)(=O)NC(C)C(=O)OCC(=O)Nc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C18H21N3O8S2/c1-12(21-31(26,27)16-9-5-14(28-2)6-10-16)18(23)29-11-17(22)20-13-3-7-15(8-4-13)30(19,24)25/h3-10,12,21H,11H2,1-2H3,(H,20,22)(H2,19,24,25) |
| InChIKey | HPIZJLYPPCPCSM-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 170.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |