C20H22N2O8S — CID 55323585
methyl 3-[[2-[2-[(4-methoxyphenyl)sulfonylamino]propanoyloxy]acetyl]amino]benzoate (PubChem CID 55323585) has the molecular formula C20H22N2O8S and a molecular weight of 450.47 g/mol. Its IUPAC name is methyl 3-[[2-[2-[(4-methoxyphenyl)sulfonylamino]propanoyloxy]acetyl]amino]benzoate.
| Compound Name | methyl 3-[[2-[2-[(4-methoxyphenyl)sulfonylamino]propanoyloxy]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 55323585 |
| Molecular Formula | C20H22N2O8S |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | methyl 3-[[2-[2-[(4-methoxyphenyl)sulfonylamino]propanoyloxy]acetyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)COC(=O)C(C)NS(=O)(=O)c2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C20H22N2O8S/c1-13(22-31(26,27)17-9-7-16(28-2)8-10-17)19(24)30-12-18(23)21-15-6-4-5-14(11-15)20(25)29-3/h4-11,13,22H,12H2,1-3H3,(H,21,23) |
| InChIKey | CNOSAZSSIBAFAR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |