C20H22N2O7S — CID 55928378
[2-(3-acetylanilino)-2-oxoethyl] (2S)-2-[(4-methoxyphenyl)sulfonylamino]propanoate (PubChem CID 55928378) has the molecular formula C20H22N2O7S and a molecular weight of 434.47 g/mol. Its IUPAC name is [2-(3-acetylanilino)-2-oxoethyl] (2S)-2-[(4-methoxyphenyl)sulfonylamino]propanoate.
| Compound Name | [2-(3-acetylanilino)-2-oxoethyl] (2S)-2-[(4-methoxyphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 55928378 |
| Molecular Formula | C20H22N2O7S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | [2-(3-acetylanilino)-2-oxoethyl] (2S)-2-[(4-methoxyphenyl)sulfonylamino]propanoate |
| SMILES | COc1ccc(S(=O)(=O)N[C@@H](C)C(=O)OCC(=O)Nc2cccc(C(C)=O)c2)cc1 |
| InChI | InChI=1S/C20H22N2O7S/c1-13(22-30(26,27)18-9-7-17(28-3)8-10-18)20(25)29-12-19(24)21-16-6-4-5-15(11-16)14(2)23/h4-11,13,22H,12H2,1-3H3,(H,21,24)/t13-/m0/s1 |
| InChIKey | PDWUUZAWMNROIJ-ZDUSSCGKSA-N |
| XLogP | 1.75 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |