C23H28N2O8S — CID 55936776
butyl 4-[[2-[(2S)-2-[(4-methoxyphenyl)sulfonylamino]propanoyl]oxyacetyl]amino]benzoate (PubChem CID 55936776) has the molecular formula C23H28N2O8S and a molecular weight of 492.55 g/mol. Its IUPAC name is butyl 4-[[2-[(2S)-2-[(4-methoxyphenyl)sulfonylamino]propanoyl]oxyacetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[(2S)-2-[(4-methoxyphenyl)sulfonylamino]propanoyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 55936776 |
| Molecular Formula | C23H28N2O8S |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | butyl 4-[[2-[(2S)-2-[(4-methoxyphenyl)sulfonylamino]propanoyl]oxyacetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)COC(=O)[C@H](C)NS(=O)(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H28N2O8S/c1-4-5-14-32-23(28)17-6-8-18(9-7-17)24-21(26)15-33-22(27)16(2)25-34(29,30)20-12-10-19(31-3)11-13-20/h6-13,16,25H,4-5,14-15H2,1-3H3,(H,24,26)/t16-/m0/s1 |
| InChIKey | YPXXCOXTGUSTHG-INIZCTEOSA-N |
| XLogP | 2.50 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|