C16H16N2O6S — CID 2510265
[2-oxo-2-(4-sulfamoylanilino)ethyl] 4-methoxybenzoate (PubChem CID 2510265) has the molecular formula C16H16N2O6S and a molecular weight of 364.38 g/mol. Its IUPAC name is [2-oxo-2-(4-sulfamoylanilino)ethyl] 4-methoxybenzoate.
| Compound Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 2510265 |
| Molecular Formula | C16H16N2O6S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)Nc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C16H16N2O6S/c1-23-13-6-2-11(3-7-13)16(20)24-10-15(19)18-12-4-8-14(9-5-12)25(17,21)22/h2-9H,10H2,1H3,(H,18,19)(H2,17,21,22) |
| InChIKey | IDAAOKPRSCBHTI-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |