C17H17NO6S — CID 2528834
[2-(4-methoxyanilino)-2-oxoethyl] 3-methylsulfonylbenzoate (PubChem CID 2528834) has the molecular formula C17H17NO6S and a molecular weight of 363.39 g/mol. Its IUPAC name is [2-(4-methoxyanilino)-2-oxoethyl] 3-methylsulfonylbenzoate.
| Compound Name | [2-(4-methoxyanilino)-2-oxoethyl] 3-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 2528834 |
| Molecular Formula | C17H17NO6S |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | [2-(4-methoxyanilino)-2-oxoethyl] 3-methylsulfonylbenzoate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2cccc(S(C)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C17H17NO6S/c1-23-14-8-6-13(7-9-14)18-16(19)11-24-17(20)12-4-3-5-15(10-12)25(2,21)22/h3-10H,11H2,1-2H3,(H,18,19) |
| InChIKey | ALXRVWDOPUPBIK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |