C12H15NO5S — CID 2528487
[2-(ethylamino)-2-oxoethyl] 3-methylsulfonylbenzoate (PubChem CID 2528487) has the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. Its IUPAC name is [2-(ethylamino)-2-oxoethyl] 3-methylsulfonylbenzoate.
| Compound Name | [2-(ethylamino)-2-oxoethyl] 3-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 2528487 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | [2-(ethylamino)-2-oxoethyl] 3-methylsulfonylbenzoate |
| SMILES | CCNC(=O)COC(=O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C12H15NO5S/c1-3-13-11(14)8-18-12(15)9-5-4-6-10(7-9)19(2,16)17/h4-7H,3,8H2,1-2H3,(H,13,14) |
| InChIKey | RCUNAUQUKZPLKW-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |